C24H32F3N3O2 — CID 66628511
N-(5-hydroxy-2-adamantyl)-2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide (PubChem CID 66628511) has the molecular formula C24H32F3N3O2 and a molecular weight of 451.53 g/mol. Its IUPAC name is N-(5-hydroxy-2-adamantyl)-2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide.
| Compound Name | N-(5-hydroxy-2-adamantyl)-2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide |
|---|---|
| PubChem CID | 66628511 |
| Molecular Formula | C24H32F3N3O2 |
| Molecular Weight | 451.53 g/mol |
| Exact Mass | 451.24 |
| IUPAC Name | N-(5-hydroxy-2-adamantyl)-2-[4-[4-(trifluoromethyl)phenyl]piperazin-1-yl]propanamide |
| SMILES | CC(C(=O)NC1C2CC3CC1CC(O)(C3)C2)N1CCN(c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C24H32F3N3O2/c1-15(22(31)28-21-17-10-16-11-18(21)14-23(32,12-16)13-17)29-6-8-30(9-7-29)20-4-2-19(3-5-20)24(25,26)27/h2-5,15-18,21,32H,6-14H2,1H3,(H,28,31) |
| InChIKey | SUOXFHNMRWWLEZ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 55.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.53 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |