C20H23NO2 — CID 66630752
(4aS,10bS)-4-benzyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-7,8-diol (PubChem CID 66630752) has the molecular formula C20H23NO2 and a molecular weight of 309.41 g/mol. Its IUPAC name is (4aS,10bS)-4-benzyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-7,8-diol.
| Compound Name | (4aS,10bS)-4-benzyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-7,8-diol |
|---|---|
| PubChem CID | 66630752 |
| Molecular Formula | C20H23NO2 |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.17 |
| IUPAC Name | (4aS,10bS)-4-benzyl-2,3,4a,5,6,10b-hexahydro-1H-benzo[f]quinoline-7,8-diol |
| SMILES | Oc1ccc2c(c1O)CC[C@H]1[C@H]2CCCN1Cc1ccccc1 |
| InChI | InChI=1S/C20H23NO2/c22-19-11-9-15-16-7-4-12-21(13-14-5-2-1-3-6-14)18(16)10-8-17(15)20(19)23/h1-3,5-6,9,11,16,18,22-23H,4,7-8,10,12-13H2/t16-,18-/m0/s1 |
| InChIKey | CQRMHBYOFPMQGH-WMZOPIPTSA-N |
| XLogP | 3.79 |
| TPSA | 43.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|