C7H10N2O5S — CID 66641771
5-[2-(dihydroxyamino)oxyethyl]-4-methyl-1,3-thiazole-2-carboxylic acid (PubChem CID 66641771) has the molecular formula C7H10N2O5S and a molecular weight of 234.23 g/mol. Its IUPAC name is 5-[2-(dihydroxyamino)oxyethyl]-4-methyl-1,3-thiazole-2-carboxylic acid.
| Compound Name | 5-[2-(dihydroxyamino)oxyethyl]-4-methyl-1,3-thiazole-2-carboxylic acid |
|---|---|
| PubChem CID | 66641771 |
| Molecular Formula | C7H10N2O5S |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.03 |
| IUPAC Name | 5-[2-(dihydroxyamino)oxyethyl]-4-methyl-1,3-thiazole-2-carboxylic acid |
| SMILES | Cc1nc(C(=O)O)sc1CCON(O)O |
| InChI | InChI=1S/C7H10N2O5S/c1-4-5(2-3-14-9(12)13)15-6(8-4)7(10)11/h12-13H,2-3H2,1H3,(H,10,11) |
| InChIKey | BFEGCZCUYFARGT-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 103.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|