C15H16N6O4S — CID 66641598
5-[2-(dihydroxyamino)oxyethyl]-4-methyl-N'-phthalazin-1-yl-1,3-thiazole-2-carbohydrazide (PubChem CID 66641598) has the molecular formula C15H16N6O4S and a molecular weight of 376.40 g/mol. Its IUPAC name is 5-[2-(dihydroxyamino)oxyethyl]-4-methyl-N'-phthalazin-1-yl-1,3-thiazole-2-carbohydrazide.
| Compound Name | 5-[2-(dihydroxyamino)oxyethyl]-4-methyl-N'-phthalazin-1-yl-1,3-thiazole-2-carbohydrazide |
|---|---|
| PubChem CID | 66641598 |
| Molecular Formula | C15H16N6O4S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.10 |
| IUPAC Name | 5-[2-(dihydroxyamino)oxyethyl]-4-methyl-N'-phthalazin-1-yl-1,3-thiazole-2-carbohydrazide |
| SMILES | Cc1nc(C(=O)NNc2nncc3ccccc23)sc1CCON(O)O |
| InChI | InChI=1S/C15H16N6O4S/c1-9-12(6-7-25-21(23)24)26-15(17-9)14(22)20-19-13-11-5-3-2-4-10(11)8-16-18-13/h2-5,8,23-24H,6-7H2,1H3,(H,18,19)(H,20,22) |
| InChIKey | HIQDEEBBANJRKX-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 132.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|