C17H23N7O2 — CID 666424
2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(4-methylpiperazin-1-yl)methyl]-1,3,5-triazine-2,4-diamine (PubChem CID 666424) has the molecular formula C17H23N7O2 and a molecular weight of 357.42 g/mol. Its IUPAC name is 2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(4-methylpiperazin-1-yl)methyl]-1,3,5-triazine-2,4-diamine.
| Compound Name | 2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(4-methylpiperazin-1-yl)methyl]-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 666424 |
| Molecular Formula | C17H23N7O2 |
| Molecular Weight | 357.42 g/mol |
| Exact Mass | 357.19 |
| IUPAC Name | 2-N-(2,3-dihydro-1,4-benzodioxin-6-yl)-6-[(4-methylpiperazin-1-yl)methyl]-1,3,5-triazine-2,4-diamine |
| SMILES | CN1CCN(Cc2nc(N)nc(Nc3ccc4c(c3)OCCO4)n2)CC1 |
| InChI | InChI=1S/C17H23N7O2/c1-23-4-6-24(7-5-23)11-15-20-16(18)22-17(21-15)19-12-2-3-13-14(10-12)26-9-8-25-13/h2-3,10H,4-9,11H2,1H3,(H3,18,19,20,21,22) |
| InChIKey | MQYYSUSHCYKIQR-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.42 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |