About 2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid
2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid (PubChem CID 66643789) has the molecular formula C14H16N2O3S
and a molecular weight of 292.36 g/mol. Its IUPAC name is 2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid.
Molecular Properties
| Compound Name | 2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid |
| PubChem CID | 66643789 |
| Molecular Formula | C14H16N2O3S |
| Molecular Weight | 292.36 g/mol |
| Exact Mass | 292.09 |
| IUPAC Name | 2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid |
| SMILES | CCCCc1noc(C)c1/C=C/c1ncc(C(=O)O)s1 |
| InChI | InChI=1S/C14H16N2O3S/c1-3-4-5-11-10(9(2)19-16-11)6-7-13-15-8-12(20-13)14(17)18/h6-8H,3-5H2,1-2H3,(H,17,18)/b7-6+ |
| InChIKey | XXKFGDRKNBGRBN-VOTSOKGWSA-N |
| XLogP | 3.65 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 292.36 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid?
The IUPAC name of 2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid (CID 66643789) is 2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid.
What is the SMILES notation for 2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid?
The canonical SMILES for 2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid is CCCCc1noc(C)c1/C=C/c1ncc(C(=O)O)s1.
What is the InChIKey of 2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid?
The InChIKey is XXKFGDRKNBGRBN-VOTSOKGWSA-N. The full InChI is InChI=1S/C14H16N2O3S/c1-3-4-5-11-10(9(2)19-16-11)6-7-13-15-8-12(20-13)14(17)18/h6-8H,3-5H2,1-2H3,(H,17,18)/b7-6+.
What are the key properties of 2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid?
2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid has a molecular weight of 292.36 g/mol, XLogP of 3.65, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(E)-2-(3-butyl-5-methyl-1,2-oxazol-4-yl)ethenyl]-1,3-thiazole-5-carboxylic acid is sourced from PubChem (CID 66643789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).