C27H23N3OS — CID 66644181
2-[3-(5-benzyl-1-phenylpyrazol-3-yl)-4H-pyridin-1-yl]-1-thiophen-2-ylethanone (PubChem CID 66644181) has the molecular formula C27H23N3OS and a molecular weight of 437.57 g/mol. Its IUPAC name is 2-[3-(5-benzyl-1-phenylpyrazol-3-yl)-4H-pyridin-1-yl]-1-thiophen-2-ylethanone.
| Compound Name | 2-[3-(5-benzyl-1-phenylpyrazol-3-yl)-4H-pyridin-1-yl]-1-thiophen-2-ylethanone |
|---|---|
| PubChem CID | 66644181 |
| Molecular Formula | C27H23N3OS |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.16 |
| IUPAC Name | 2-[3-(5-benzyl-1-phenylpyrazol-3-yl)-4H-pyridin-1-yl]-1-thiophen-2-ylethanone |
| SMILES | O=C(CN1C=CCC(c2cc(Cc3ccccc3)n(-c3ccccc3)n2)=C1)c1cccs1 |
| InChI | InChI=1S/C27H23N3OS/c31-26(27-14-8-16-32-27)20-29-15-7-11-22(19-29)25-18-24(17-21-9-3-1-4-10-21)30(28-25)23-12-5-2-6-13-23/h1-10,12-16,18-19H,11,17,20H2 |
| InChIKey | KYUQKUYJOHHASQ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 38.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |