C13H12F3NO4 — CID 66645103
(2R)-5-oxo-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxylic acid (PubChem CID 66645103) has the molecular formula C13H12F3NO4 and a molecular weight of 303.24 g/mol. Its IUPAC name is (2R)-5-oxo-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-5-oxo-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 66645103 |
| Molecular Formula | C13H12F3NO4 |
| Molecular Weight | 303.24 g/mol |
| Exact Mass | 303.07 |
| IUPAC Name | (2R)-5-oxo-1-[[2-(trifluoromethoxy)phenyl]methyl]pyrrolidine-2-carboxylic acid |
| SMILES | O=C(O)[C@H]1CCC(=O)N1Cc1ccccc1OC(F)(F)F |
| InChI | InChI=1S/C13H12F3NO4/c14-13(15,16)21-10-4-2-1-3-8(10)7-17-9(12(19)20)5-6-11(17)18/h1-4,9H,5-7H2,(H,19,20)/t9-/m1/s1 |
| InChIKey | NQVIPZJHQGHFCS-SECBINFHSA-N |
| XLogP | 2.16 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.24 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |