C20H19F3N2O4 — CID 56766019
4-benzyl-5-oxo-N-[[2-(trifluoromethoxy)phenyl]methyl]morpholine-3-carboxamide (PubChem CID 56766019) has the molecular formula C20H19F3N2O4 and a molecular weight of 408.38 g/mol. Its IUPAC name is 4-benzyl-5-oxo-N-[[2-(trifluoromethoxy)phenyl]methyl]morpholine-3-carboxamide.
| Compound Name | 4-benzyl-5-oxo-N-[[2-(trifluoromethoxy)phenyl]methyl]morpholine-3-carboxamide |
|---|---|
| PubChem CID | 56766019 |
| Molecular Formula | C20H19F3N2O4 |
| Molecular Weight | 408.38 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 4-benzyl-5-oxo-N-[[2-(trifluoromethoxy)phenyl]methyl]morpholine-3-carboxamide |
| SMILES | O=C(NCc1ccccc1OC(F)(F)F)C1COCC(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C20H19F3N2O4/c21-20(22,23)29-17-9-5-4-8-15(17)10-24-19(27)16-12-28-13-18(26)25(16)11-14-6-2-1-3-7-14/h1-9,16H,10-13H2,(H,24,27) |
| InChIKey | KQZKZFCAWGACTD-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.38 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |