C17H14O4 — CID 66647245
4-(2-carboxyphenyl)-2,3-dihydro-1H-indene-5-carboxylic acid (PubChem CID 66647245) has the molecular formula C17H14O4 and a molecular weight of 282.30 g/mol. Its IUPAC name is 4-(2-carboxyphenyl)-2,3-dihydro-1H-indene-5-carboxylic acid.
| Compound Name | 4-(2-carboxyphenyl)-2,3-dihydro-1H-indene-5-carboxylic acid |
|---|---|
| PubChem CID | 66647245 |
| Molecular Formula | C17H14O4 |
| Molecular Weight | 282.30 g/mol |
| Exact Mass | 282.09 |
| IUPAC Name | 4-(2-carboxyphenyl)-2,3-dihydro-1H-indene-5-carboxylic acid |
| SMILES | O=C(O)c1ccccc1-c1c(C(=O)O)ccc2c1CCC2 |
| InChI | InChI=1S/C17H14O4/c18-16(19)13-6-2-1-5-12(13)15-11-7-3-4-10(11)8-9-14(15)17(20)21/h1-2,5-6,8-9H,3-4,7H2,(H,18,19)(H,20,21) |
| InChIKey | XTWRTQDXYMVIEQ-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.30 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |