C20H19N3O2S2 — CID 66648603
5,5-dimethyl-2-[6-(1,3-thiazol-2-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]-4,6-dihydro-1,3-benzothiazol-7-one (PubChem CID 66648603) has the molecular formula C20H19N3O2S2 and a molecular weight of 397.53 g/mol. Its IUPAC name is 5,5-dimethyl-2-[6-(1,3-thiazol-2-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]-4,6-dihydro-1,3-benzothiazol-7-one.
| Compound Name | 5,5-dimethyl-2-[6-(1,3-thiazol-2-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]-4,6-dihydro-1,3-benzothiazol-7-one |
|---|---|
| PubChem CID | 66648603 |
| Molecular Formula | C20H19N3O2S2 |
| Molecular Weight | 397.53 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 5,5-dimethyl-2-[6-(1,3-thiazol-2-yl)-2,3-dihydro-1,4-benzoxazin-4-yl]-4,6-dihydro-1,3-benzothiazol-7-one |
| SMILES | CC1(C)CC(=O)c2sc(N3CCOc4ccc(-c5nccs5)cc43)nc2C1 |
| InChI | InChI=1S/C20H19N3O2S2/c1-20(2)10-13-17(15(24)11-20)27-19(22-13)23-6-7-25-16-4-3-12(9-14(16)23)18-21-5-8-26-18/h3-5,8-9H,6-7,10-11H2,1-2H3 |
| InChIKey | QQDHJXGANDPAPX-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.53 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |