C32H28ClFN4O3S — CID 66648879
2-[4-[2-[4-[[2-chloroethyl(methyl)amino]methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxy-3-fluorophenyl]-N'-phenylpropanediamide (PubChem CID 66648879) has the molecular formula C32H28ClFN4O3S and a molecular weight of 603.12 g/mol. Its IUPAC name is 2-[4-[2-[4-[[2-chloroethyl(methyl)amino]methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxy-3-fluorophenyl]-N'-phenylpropanediamide.
| Compound Name | 2-[4-[2-[4-[[2-chloroethyl(methyl)amino]methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxy-3-fluorophenyl]-N'-phenylpropanediamide |
|---|---|
| PubChem CID | 66648879 |
| Molecular Formula | C32H28ClFN4O3S |
| Molecular Weight | 603.12 g/mol |
| Exact Mass | 602.16 |
| IUPAC Name | 2-[4-[2-[4-[[2-chloroethyl(methyl)amino]methyl]phenyl]thieno[3,2-b]pyridin-7-yl]oxy-3-fluorophenyl]-N'-phenylpropanediamide |
| SMILES | CN(CCCl)Cc1ccc(-c2cc3nccc(Oc4ccc(C(C(N)=O)C(=O)Nc5ccccc5)cc4F)c3s2)cc1 |
| InChI | InChI=1S/C32H28ClFN4O3S/c1-38(16-14-33)19-20-7-9-21(10-8-20)28-18-25-30(42-28)27(13-15-36-25)41-26-12-11-22(17-24(26)34)29(31(35)39)32(40)37-23-5-3-2-4-6-23/h2-13,15,17-18,29H,14,16,19H2,1H3,(H2,35,39)(H,37,40) |
| InChIKey | IVYSYFMONLPWTA-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 97.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.12 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|