C27H32FNO3 — CID 66655411
tert-butyl 3-[6-[2-(4-fluorophenyl)ethenyl]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate (PubChem CID 66655411) has the molecular formula C27H32FNO3 and a molecular weight of 437.56 g/mol. Its IUPAC name is tert-butyl 3-[6-[2-(4-fluorophenyl)ethenyl]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate.
| Compound Name | tert-butyl 3-[6-[2-(4-fluorophenyl)ethenyl]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate |
|---|---|
| PubChem CID | 66655411 |
| Molecular Formula | C27H32FNO3 |
| Molecular Weight | 437.56 g/mol |
| Exact Mass | 437.24 |
| IUPAC Name | tert-butyl 3-[6-[2-(4-fluorophenyl)ethenyl]spiro[2H-1-benzofuran-3,4'-piperidine]-1'-yl]propanoate |
| SMILES | CC(C)(C)OC(=O)CCN1CCC2(CC1)COc1cc(C=Cc3ccc(F)cc3)ccc12 |
| InChI | InChI=1S/C27H32FNO3/c1-26(2,3)32-25(30)12-15-29-16-13-27(14-17-29)19-31-24-18-21(8-11-23(24)27)5-4-20-6-9-22(28)10-7-20/h4-11,18H,12-17,19H2,1-3H3 |
| InChIKey | DFMOYDRLPNFIDC-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.56 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|