C16H22SSi — CID 66657413
2-(2-hept-1-ynylthiophen-3-yl)ethynyl-trimethylsilane (PubChem CID 66657413) has the molecular formula C16H22SSi and a molecular weight of 274.50 g/mol. Its IUPAC name is 2-(2-hept-1-ynylthiophen-3-yl)ethynyl-trimethylsilane.
| Compound Name | 2-(2-hept-1-ynylthiophen-3-yl)ethynyl-trimethylsilane |
|---|---|
| PubChem CID | 66657413 |
| Molecular Formula | C16H22SSi |
| Molecular Weight | 274.50 g/mol |
| Exact Mass | 274.12 |
| IUPAC Name | 2-(2-hept-1-ynylthiophen-3-yl)ethynyl-trimethylsilane |
| SMILES | CCCCCC#Cc1sccc1C#C[Si](C)(C)C |
| InChI | InChI=1S/C16H22SSi/c1-5-6-7-8-9-10-16-15(11-13-17-16)12-14-18(2,3)4/h11,13H,5-8H2,1-4H3 |
| InChIKey | CQQLRPWLYMJTNN-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.50 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|