C14H16FN3O — CID 66657446
N-(7-fluoro-2-methylquinazolin-5-yl)-2,2-dimethylpropanamide (PubChem CID 66657446) has the molecular formula C14H16FN3O and a molecular weight of 261.30 g/mol. Its IUPAC name is N-(7-fluoro-2-methylquinazolin-5-yl)-2,2-dimethylpropanamide.
| Compound Name | N-(7-fluoro-2-methylquinazolin-5-yl)-2,2-dimethylpropanamide |
|---|---|
| PubChem CID | 66657446 |
| Molecular Formula | C14H16FN3O |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.13 |
| IUPAC Name | N-(7-fluoro-2-methylquinazolin-5-yl)-2,2-dimethylpropanamide |
| SMILES | Cc1ncc2c(NC(=O)C(C)(C)C)cc(F)cc2n1 |
| InChI | InChI=1S/C14H16FN3O/c1-8-16-7-10-11(17-8)5-9(15)6-12(10)18-13(19)14(2,3)4/h5-7H,1-4H3,(H,18,19) |
| InChIKey | FHAYVRRALZIPTF-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |