C36H31FN4O6 — CID 66660150
1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-8-methyl-2-oxo-N-(2-phenylmethoxyethyl)-1,5-naphthyridine-3-carboxamide (PubChem CID 66660150) has the molecular formula C36H31FN4O6 and a molecular weight of 634.66 g/mol. Its IUPAC name is 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-8-methyl-2-oxo-N-(2-phenylmethoxyethyl)-1,5-naphthyridine-3-carboxamide.
| Compound Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-8-methyl-2-oxo-N-(2-phenylmethoxyethyl)-1,5-naphthyridine-3-carboxamide |
|---|---|
| PubChem CID | 66660150 |
| Molecular Formula | C36H31FN4O6 |
| Molecular Weight | 634.66 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | 1-[2-(1,3-dioxoisoindol-2-yl)ethyl]-7-[(4-fluorophenyl)methyl]-4-hydroxy-8-methyl-2-oxo-N-(2-phenylmethoxyethyl)-1,5-naphthyridine-3-carboxamide |
| SMILES | Cc1c(Cc2ccc(F)cc2)cnc2c(O)c(C(=O)NCCOCc3ccccc3)c(=O)n(CCN3C(=O)c4ccccc4C3=O)c12 |
| InChI | InChI=1S/C36H31FN4O6/c1-22-25(19-23-11-13-26(37)14-12-23)20-39-30-31(22)40(16-17-41-34(44)27-9-5-6-10-28(27)35(41)45)36(46)29(32(30)42)33(43)38-15-18-47-21-24-7-3-2-4-8-24/h2-14,20,42H,15-19,21H2,1H3,(H,38,43) |
| InChIKey | KMCWHWKXSVRVFG-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.66 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|