C23H26F3N5O2 — CID 66661193
12,12-difluoro-8-[(4-fluorophenyl)methyl]-4-hydroxy-N-[3-(methylamino)propyl]-1,6,10-triazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraene-3-carboxamide (PubChem CID 66661193) has the molecular formula C23H26F3N5O2 and a molecular weight of 461.49 g/mol. Its IUPAC name is 12,12-difluoro-8-[(4-fluorophenyl)methyl]-4-hydroxy-N-[3-(methylamino)propyl]-1,6,10-triazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraene-3-carboxamide.
| Compound Name | 12,12-difluoro-8-[(4-fluorophenyl)methyl]-4-hydroxy-N-[3-(methylamino)propyl]-1,6,10-triazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraene-3-carboxamide |
|---|---|
| PubChem CID | 66661193 |
| Molecular Formula | C23H26F3N5O2 |
| Molecular Weight | 461.49 g/mol |
| Exact Mass | 461.20 |
| IUPAC Name | 12,12-difluoro-8-[(4-fluorophenyl)methyl]-4-hydroxy-N-[3-(methylamino)propyl]-1,6,10-triazatricyclo[7.4.1.05,14]tetradeca-3,5,7,9(14)-tetraene-3-carboxamide |
| SMILES | CNCCCNC(=O)C1=C(O)c2ncc(Cc3ccc(F)cc3)c3c2N(C1)CC(F)(F)CN3 |
| InChI | InChI=1S/C23H26F3N5O2/c1-27-7-2-8-28-22(33)17-11-31-13-23(25,26)12-30-18-15(9-14-3-5-16(24)6-4-14)10-29-19(20(18)31)21(17)32/h3-6,10,27,30,32H,2,7-9,11-13H2,1H3,(H,28,33) |
| InChIKey | VUBICRGSOUULST-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 89.52 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|