C24H25FN4O5 — CID 90994002
3-N,3-N-diethyl-6-[(4-fluorophenyl)methyl]-12-hydroxy-11-N-methyl-10-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5(13),6,8-tetraene-3,11-dicarboxamide (PubChem CID 90994002) has the molecular formula C24H25FN4O5 and a molecular weight of 468.49 g/mol. Its IUPAC name is 3-N,3-N-diethyl-6-[(4-fluorophenyl)methyl]-12-hydroxy-11-N-methyl-10-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5(13),6,8-tetraene-3,11-dicarboxamide.
| Compound Name | 3-N,3-N-diethyl-6-[(4-fluorophenyl)methyl]-12-hydroxy-11-N-methyl-10-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5(13),6,8-tetraene-3,11-dicarboxamide |
|---|---|
| PubChem CID | 90994002 |
| Molecular Formula | C24H25FN4O5 |
| Molecular Weight | 468.49 g/mol |
| Exact Mass | 468.18 |
| IUPAC Name | 3-N,3-N-diethyl-6-[(4-fluorophenyl)methyl]-12-hydroxy-11-N-methyl-10-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5(13),6,8-tetraene-3,11-dicarboxamide |
| SMILES | CCN(CC)C(=O)C1=CN2c3c(ncc(Cc4ccc(F)cc4)c3O1)C(=O)C(C(=O)NC)C2O |
| InChI | InChI=1S/C24H25FN4O5/c1-4-28(5-2)23(32)16-12-29-19-18(20(30)17(24(29)33)22(31)26-3)27-11-14(21(19)34-16)10-13-6-8-15(25)9-7-13/h6-9,11-12,17,24,33H,4-5,10H2,1-3H3,(H,26,31) |
| InChIKey | UJEYPGALDAJHTA-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.49 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|