C25H23FN2O7 — CID 66659066
10-butoxy-11-ethoxycarbonyl-6-[(4-fluorophenyl)methyl]-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,10-pentaene-3-carboxylic acid (PubChem CID 66659066) has the molecular formula C25H23FN2O7 and a molecular weight of 482.46 g/mol. Its IUPAC name is 10-butoxy-11-ethoxycarbonyl-6-[(4-fluorophenyl)methyl]-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,10-pentaene-3-carboxylic acid.
| Compound Name | 10-butoxy-11-ethoxycarbonyl-6-[(4-fluorophenyl)methyl]-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,10-pentaene-3-carboxylic acid |
|---|---|
| PubChem CID | 66659066 |
| Molecular Formula | C25H23FN2O7 |
| Molecular Weight | 482.46 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 10-butoxy-11-ethoxycarbonyl-6-[(4-fluorophenyl)methyl]-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-2,5(13),6,8,10-pentaene-3-carboxylic acid |
| SMILES | CCCCOc1c(C(=O)OCC)c(=O)n2c3c(c(Cc4ccc(F)cc4)cnc13)OC(C(=O)O)=C2 |
| InChI | InChI=1S/C25H23FN2O7/c1-3-5-10-34-22-18(25(32)33-4-2)23(29)28-13-17(24(30)31)35-21-15(12-27-19(22)20(21)28)11-14-6-8-16(26)9-7-14/h6-9,12-13H,3-5,10-11H2,1-2H3,(H,30,31) |
| InChIKey | AKYZOMCAFHGBLJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 116.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.46 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|