C27H30FN3O6 — CID 66661154
ethyl 10-butoxy-3-(dimethylcarbamoyl)-6-[(4-fluorophenyl)methyl]-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate (PubChem CID 66661154) has the molecular formula C27H30FN3O6 and a molecular weight of 511.55 g/mol. Its IUPAC name is ethyl 10-butoxy-3-(dimethylcarbamoyl)-6-[(4-fluorophenyl)methyl]-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate.
| Compound Name | ethyl 10-butoxy-3-(dimethylcarbamoyl)-6-[(4-fluorophenyl)methyl]-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate |
|---|---|
| PubChem CID | 66661154 |
| Molecular Formula | C27H30FN3O6 |
| Molecular Weight | 511.55 g/mol |
| Exact Mass | 511.21 |
| IUPAC Name | ethyl 10-butoxy-3-(dimethylcarbamoyl)-6-[(4-fluorophenyl)methyl]-12-oxo-4-oxa-1,8-diazatricyclo[7.3.1.05,13]trideca-5(13),6,8,10-tetraene-11-carboxylate |
| SMILES | CCCCOc1c(C(=O)OCC)c(=O)n2c3c(c(Cc4ccc(F)cc4)cnc13)OC(C(=O)N(C)C)C2 |
| InChI | InChI=1S/C27H30FN3O6/c1-5-7-12-36-24-20(27(34)35-6-2)26(33)31-15-19(25(32)30(3)4)37-23-17(14-29-21(24)22(23)31)13-16-8-10-18(28)11-9-16/h8-11,14,19H,5-7,12-13,15H2,1-4H3 |
| InChIKey | JWDKJUWSFKBXBX-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.55 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|