C26H30BrFN2O4 — CID 89109866
ethyl 8-bromo-4-butoxy-7-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1-(2-methylprop-2-enyl)-2-oxo-1,5-naphthyridine-3-carboxylate (PubChem CID 89109866) has the molecular formula C26H30BrFN2O4 and a molecular weight of 533.44 g/mol. Its IUPAC name is ethyl 8-bromo-4-butoxy-7-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1-(2-methylprop-2-enyl)-2-oxo-1,5-naphthyridine-3-carboxylate.
| Compound Name | ethyl 8-bromo-4-butoxy-7-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1-(2-methylprop-2-enyl)-2-oxo-1,5-naphthyridine-3-carboxylate |
|---|---|
| PubChem CID | 89109866 |
| Molecular Formula | C26H30BrFN2O4 |
| Molecular Weight | 533.44 g/mol |
| Exact Mass | 532.14 |
| IUPAC Name | ethyl 8-bromo-4-butoxy-7-[(4-fluorocyclohexa-1,5-dien-1-yl)methyl]-1-(2-methylprop-2-enyl)-2-oxo-1,5-naphthyridine-3-carboxylate |
| SMILES | C=C(C)Cn1c(=O)c(C(=O)OCC)c(OCCCC)c2ncc(CC3=CCC(F)C=C3)c(Br)c21 |
| InChI | InChI=1S/C26H30BrFN2O4/c1-5-7-12-34-24-20(26(32)33-6-2)25(31)30(15-16(3)4)23-21(27)18(14-29-22(23)24)13-17-8-10-19(28)11-9-17/h8-10,14,19H,3,5-7,11-13,15H2,1-2,4H3 |
| InChIKey | PPGFJEPMULRTLY-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.44 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|