C21H23FN4O5 — CID 143931749
(Z)-3-[4-acetyl-8-[(4-fluorophenyl)methyl]-2,3-dihydropyrido[4,3-b][1,4]oxazin-5-yl]-3-hydroxy-N-methylprop-2-enamide;nitrosomethane (PubChem CID 143931749) has the molecular formula C21H23FN4O5 and a molecular weight of 430.44 g/mol. Its IUPAC name is (Z)-3-[4-acetyl-8-[(4-fluorophenyl)methyl]-2,3-dihydropyrido[4,3-b][1,4]oxazin-5-yl]-3-hydroxy-N-methylprop-2-enamide;nitrosomethane.
| Compound Name | (Z)-3-[4-acetyl-8-[(4-fluorophenyl)methyl]-2,3-dihydropyrido[4,3-b][1,4]oxazin-5-yl]-3-hydroxy-N-methylprop-2-enamide;nitrosomethane |
|---|---|
| PubChem CID | 143931749 |
| Molecular Formula | C21H23FN4O5 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (Z)-3-[4-acetyl-8-[(4-fluorophenyl)methyl]-2,3-dihydropyrido[4,3-b][1,4]oxazin-5-yl]-3-hydroxy-N-methylprop-2-enamide;nitrosomethane |
| SMILES | CN=O.CNC(=O)/C=C(\O)c1ncc(Cc2ccc(F)cc2)c2c1N(C(C)=O)CCO2 |
| InChI | InChI=1S/C20H20FN3O4.CH3NO/c1-12(25)24-7-8-28-20-14(9-13-3-5-15(21)6-4-13)11-23-18(19(20)24)16(26)10-17(27)22-2;1-2-3/h3-6,10-11,26H,7-9H2,1-2H3,(H,22,27);1H3/b16-10-; |
| InChIKey | QTXBFZVKRSPIQE-HYMQDMCPSA-N |
| XLogP | 2.58 |
| TPSA | 121.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|