C9H9ClN2O2 — CID 122637576
1-(5-chloro-2,3-dihydropyrido[3,4-b][1,4]oxazin-1-yl)ethanone (PubChem CID 122637576) has the molecular formula C9H9ClN2O2 and a molecular weight of 212.64 g/mol. Its IUPAC name is 1-(5-chloro-2,3-dihydropyrido[3,4-b][1,4]oxazin-1-yl)ethanone.
| Compound Name | 1-(5-chloro-2,3-dihydropyrido[3,4-b][1,4]oxazin-1-yl)ethanone |
|---|---|
| PubChem CID | 122637576 |
| Molecular Formula | C9H9ClN2O2 |
| Molecular Weight | 212.64 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | 1-(5-chloro-2,3-dihydropyrido[3,4-b][1,4]oxazin-1-yl)ethanone |
| SMILES | CC(=O)N1CCOc2c1ccnc2Cl |
| InChI | InChI=1S/C9H9ClN2O2/c1-6(13)12-4-5-14-8-7(12)2-3-11-9(8)10/h2-3H,4-5H2,1H3 |
| InChIKey | JYEUTVYNJVJLBD-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.64 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|