C10H9FN2O2 — CID 66662047
4-fluorospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one (PubChem CID 66662047) has the molecular formula C10H9FN2O2 and a molecular weight of 208.19 g/mol. Its IUPAC name is 4-fluorospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one.
| Compound Name | 4-fluorospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one |
|---|---|
| PubChem CID | 66662047 |
| Molecular Formula | C10H9FN2O2 |
| Molecular Weight | 208.19 g/mol |
| Exact Mass | 208.06 |
| IUPAC Name | 4-fluorospiro[furo[3,4-c]pyridine-1,3'-pyrrolidine]-3-one |
| SMILES | O=C1OC2(CCNC2)c2ccnc(F)c21 |
| InChI | InChI=1S/C10H9FN2O2/c11-8-7-6(1-3-13-8)10(15-9(7)14)2-4-12-5-10/h1,3,12H,2,4-5H2 |
| InChIKey | GDNWELNGRWICNU-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.19 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|