C10H16N2O — CID 66662786
3-amino-N,N-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxamide (PubChem CID 66662786) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-amino-N,N-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxamide.
| Compound Name | 3-amino-N,N-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
|---|---|
| PubChem CID | 66662786 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-amino-N,N-dimethylbicyclo[2.2.1]hept-5-ene-2-carboxamide |
| SMILES | CN(C)C(=O)C1C2C=CC(C2)C1N |
| InChI | InChI=1S/C10H16N2O/c1-12(2)10(13)8-6-3-4-7(5-6)9(8)11/h3-4,6-9H,5,11H2,1-2H3 |
| InChIKey | ZQRQEGGPOBYCFE-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|