C18H18BrNO2 — CID 66669081
3-(4-bromophenyl)-3-cyclobutyl-1-(1-oxidopyridin-1-ium-3-yl)propan-1-one (PubChem CID 66669081) has the molecular formula C18H18BrNO2 and a molecular weight of 360.25 g/mol. Its IUPAC name is 3-(4-bromophenyl)-3-cyclobutyl-1-(1-oxidopyridin-1-ium-3-yl)propan-1-one.
| Compound Name | 3-(4-bromophenyl)-3-cyclobutyl-1-(1-oxidopyridin-1-ium-3-yl)propan-1-one |
|---|---|
| PubChem CID | 66669081 |
| Molecular Formula | C18H18BrNO2 |
| Molecular Weight | 360.25 g/mol |
| Exact Mass | 359.05 |
| IUPAC Name | 3-(4-bromophenyl)-3-cyclobutyl-1-(1-oxidopyridin-1-ium-3-yl)propan-1-one |
| SMILES | O=C(CC(c1ccc(Br)cc1)C1CCC1)c1ccc[n+]([O-])c1 |
| InChI | InChI=1S/C18H18BrNO2/c19-16-8-6-14(7-9-16)17(13-3-1-4-13)11-18(21)15-5-2-10-20(22)12-15/h2,5-10,12-13,17H,1,3-4,11H2 |
| InChIKey | QBLHPSRIAXZVPT-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 44.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.25 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|