C8H9NO4 — CID 66671666
4-methyl-4-nitrocyclohexa-1,5-diene-1-carboxylic acid (PubChem CID 66671666) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is 4-methyl-4-nitrocyclohexa-1,5-diene-1-carboxylic acid.
| Compound Name | 4-methyl-4-nitrocyclohexa-1,5-diene-1-carboxylic acid |
|---|---|
| PubChem CID | 66671666 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 4-methyl-4-nitrocyclohexa-1,5-diene-1-carboxylic acid |
| SMILES | CC1([N+](=O)[O-])C=CC(C(=O)O)=CC1 |
| InChI | InChI=1S/C8H9NO4/c1-8(9(12)13)4-2-6(3-5-8)7(10)11/h2-4H,5H2,1H3,(H,10,11) |
| InChIKey | CSNBJPYDBWCGIX-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 80.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|