C13H17ClFNO3 — CID 66671778
tert-butyl-[1-(3-chloro-2-fluorophenyl)-2-hydroxyethyl]carbamic acid (PubChem CID 66671778) has the molecular formula C13H17ClFNO3 and a molecular weight of 289.73 g/mol. Its IUPAC name is tert-butyl-[1-(3-chloro-2-fluorophenyl)-2-hydroxyethyl]carbamic acid.
| Compound Name | tert-butyl-[1-(3-chloro-2-fluorophenyl)-2-hydroxyethyl]carbamic acid |
|---|---|
| PubChem CID | 66671778 |
| Molecular Formula | C13H17ClFNO3 |
| Molecular Weight | 289.73 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | tert-butyl-[1-(3-chloro-2-fluorophenyl)-2-hydroxyethyl]carbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)C(CO)c1cccc(Cl)c1F |
| InChI | InChI=1S/C13H17ClFNO3/c1-13(2,3)16(12(18)19)10(7-17)8-5-4-6-9(14)11(8)15/h4-6,10,17H,7H2,1-3H3,(H,18,19) |
| InChIKey | RRJGKWZVRZQUNF-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 60.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.73 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |