C10H9ClFNO3 — CID 114488213
2-(3-chloro-2-fluorophenyl)-2-[formyl(methyl)amino]acetic acid (PubChem CID 114488213) has the molecular formula C10H9ClFNO3 and a molecular weight of 245.64 g/mol. Its IUPAC name is 2-(3-chloro-2-fluorophenyl)-2-[formyl(methyl)amino]acetic acid.
| Compound Name | 2-(3-chloro-2-fluorophenyl)-2-[formyl(methyl)amino]acetic acid |
|---|---|
| PubChem CID | 114488213 |
| Molecular Formula | C10H9ClFNO3 |
| Molecular Weight | 245.64 g/mol |
| Exact Mass | 245.03 |
| IUPAC Name | 2-(3-chloro-2-fluorophenyl)-2-[formyl(methyl)amino]acetic acid |
| SMILES | CN(C=O)C(C(=O)O)c1cccc(Cl)c1F |
| InChI | InChI=1S/C10H9ClFNO3/c1-13(5-14)9(10(15)16)6-3-2-4-7(11)8(6)12/h2-5,9H,1H3,(H,15,16) |
| InChIKey | ZLCCQHURIMOFIZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.64 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|