C17H16N2O3S — CID 66678276
3-(2-methylphenyl)-2,2-dioxo-1-prop-2-enylpyrido[3,4-c]thiazin-4-ol (PubChem CID 66678276) has the molecular formula C17H16N2O3S and a molecular weight of 328.39 g/mol. Its IUPAC name is 3-(2-methylphenyl)-2,2-dioxo-1-prop-2-enylpyrido[3,4-c]thiazin-4-ol.
| Compound Name | 3-(2-methylphenyl)-2,2-dioxo-1-prop-2-enylpyrido[3,4-c]thiazin-4-ol |
|---|---|
| PubChem CID | 66678276 |
| Molecular Formula | C17H16N2O3S |
| Molecular Weight | 328.39 g/mol |
| Exact Mass | 328.09 |
| IUPAC Name | 3-(2-methylphenyl)-2,2-dioxo-1-prop-2-enylpyrido[3,4-c]thiazin-4-ol |
| SMILES | C=CCN1c2cnccc2C(O)=C(c2ccccc2C)S1(=O)=O |
| InChI | InChI=1S/C17H16N2O3S/c1-3-10-19-15-11-18-9-8-14(15)16(20)17(23(19,21)22)13-7-5-4-6-12(13)2/h3-9,11,20H,1,10H2,2H3 |
| InChIKey | DTRIJBDFCXJQSG-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 70.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.39 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|