C14H23NO6 — CID 66679596
cis-(1R,2R)-1-methoxycarbonyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid (PubChem CID 66679596) has the molecular formula C14H23NO6 and a molecular weight of 301.34 g/mol. Its IUPAC name is cis-(1R,2R)-1-methoxycarbonyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid.
| Compound Name | cis-(1R,2R)-1-methoxycarbonyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 66679596 |
| Molecular Formula | C14H23NO6 |
| Molecular Weight | 301.34 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | cis-(1R,2R)-1-methoxycarbonyl-2-[(2-methylpropan-2-yl)oxycarbonylamino]cyclohexane-1-carboxylic acid |
| SMILES | COC(=O)[C@]1(C(=O)O)CCCC[C@H]1NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H23NO6/c1-13(2,3)21-12(19)15-9-7-5-6-8-14(9,10(16)17)11(18)20-4/h9H,5-8H2,1-4H3,(H,15,19)(H,16,17)/t9-,14-/m1/s1 |
| InChIKey | OGQXPGDDVOHTKZ-YMTOWFKASA-N |
| XLogP | 1.70 |
| TPSA | 101.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|