C22H29FN2O2 — CID 66679983
4-(4-fluoro-N-methylanilino)-N-methyl-N-[(2-propan-2-yloxyphenyl)methyl]butanamide (PubChem CID 66679983) has the molecular formula C22H29FN2O2 and a molecular weight of 372.48 g/mol. Its IUPAC name is 4-(4-fluoro-N-methylanilino)-N-methyl-N-[(2-propan-2-yloxyphenyl)methyl]butanamide.
| Compound Name | 4-(4-fluoro-N-methylanilino)-N-methyl-N-[(2-propan-2-yloxyphenyl)methyl]butanamide |
|---|---|
| PubChem CID | 66679983 |
| Molecular Formula | C22H29FN2O2 |
| Molecular Weight | 372.48 g/mol |
| Exact Mass | 372.22 |
| IUPAC Name | 4-(4-fluoro-N-methylanilino)-N-methyl-N-[(2-propan-2-yloxyphenyl)methyl]butanamide |
| SMILES | CC(C)Oc1ccccc1CN(C)C(=O)CCCN(C)c1ccc(F)cc1 |
| InChI | InChI=1S/C22H29FN2O2/c1-17(2)27-21-9-6-5-8-18(21)16-25(4)22(26)10-7-15-24(3)20-13-11-19(23)12-14-20/h5-6,8-9,11-14,17H,7,10,15-16H2,1-4H3 |
| InChIKey | DOKIQNNFAKKAEK-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.48 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |