C22H32O8 — CID 66681293
bis(3-but-2-enoyloxypropyl) cyclohexane-1,2-dicarboxylate (PubChem CID 66681293) has the molecular formula C22H32O8 and a molecular weight of 424.49 g/mol. Its IUPAC name is bis(3-but-2-enoyloxypropyl) cyclohexane-1,2-dicarboxylate.
| Compound Name | bis(3-but-2-enoyloxypropyl) cyclohexane-1,2-dicarboxylate |
|---|---|
| PubChem CID | 66681293 |
| Molecular Formula | C22H32O8 |
| Molecular Weight | 424.49 g/mol |
| Exact Mass | 424.21 |
| IUPAC Name | bis(3-but-2-enoyloxypropyl) cyclohexane-1,2-dicarboxylate |
| SMILES | CC=CC(=O)OCCCOC(=O)C1CCCCC1C(=O)OCCCOC(=O)C=CC |
| InChI | InChI=1S/C22H32O8/c1-3-9-19(23)27-13-7-15-29-21(25)17-11-5-6-12-18(17)22(26)30-16-8-14-28-20(24)10-4-2/h3-4,9-10,17-18H,5-8,11-16H2,1-2H3 |
| InChIKey | KLPIVINVNBXZDS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.49 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|