C25H23NO2 — CID 66683419
2-(2,6-dimethyl-4-phenylphenyl)-4-(pyridin-2-ylmethyl)cyclopentane-1,3-dione (PubChem CID 66683419) has the molecular formula C25H23NO2 and a molecular weight of 369.46 g/mol. Its IUPAC name is 2-(2,6-dimethyl-4-phenylphenyl)-4-(pyridin-2-ylmethyl)cyclopentane-1,3-dione.
| Compound Name | 2-(2,6-dimethyl-4-phenylphenyl)-4-(pyridin-2-ylmethyl)cyclopentane-1,3-dione |
|---|---|
| PubChem CID | 66683419 |
| Molecular Formula | C25H23NO2 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.17 |
| IUPAC Name | 2-(2,6-dimethyl-4-phenylphenyl)-4-(pyridin-2-ylmethyl)cyclopentane-1,3-dione |
| SMILES | Cc1cc(-c2ccccc2)cc(C)c1C1C(=O)CC(Cc2ccccn2)C1=O |
| InChI | InChI=1S/C25H23NO2/c1-16-12-19(18-8-4-3-5-9-18)13-17(2)23(16)24-22(27)15-20(25(24)28)14-21-10-6-7-11-26-21/h3-13,20,24H,14-15H2,1-2H3 |
| InChIKey | GGUCDDFLQQJNDY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|