C27H26F4N4O3 — CID 66686263
N-[2-[cyclohexanecarbonyl-(2-fluorobenzoyl)amino]ethyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide (PubChem CID 66686263) has the molecular formula C27H26F4N4O3 and a molecular weight of 530.52 g/mol. Its IUPAC name is N-[2-[cyclohexanecarbonyl-(2-fluorobenzoyl)amino]ethyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide.
| Compound Name | N-[2-[cyclohexanecarbonyl-(2-fluorobenzoyl)amino]ethyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
|---|---|
| PubChem CID | 66686263 |
| Molecular Formula | C27H26F4N4O3 |
| Molecular Weight | 530.52 g/mol |
| Exact Mass | 530.19 |
| IUPAC Name | N-[2-[cyclohexanecarbonyl-(2-fluorobenzoyl)amino]ethyl]-1-phenyl-3-(trifluoromethyl)pyrazole-4-carboxamide |
| SMILES | O=C(NCCN(C(=O)c1ccccc1F)C(=O)C1CCCCC1)c1cn(-c2ccccc2)nc1C(F)(F)F |
| InChI | InChI=1S/C27H26F4N4O3/c28-22-14-8-7-13-20(22)26(38)34(25(37)18-9-3-1-4-10-18)16-15-32-24(36)21-17-35(19-11-5-2-6-12-19)33-23(21)27(29,30)31/h2,5-8,11-14,17-18H,1,3-4,9-10,15-16H2,(H,32,36) |
| InChIKey | BQCAMXLPFSKMBO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.52 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|