C26H33F3N6O3 — CID 66694052
4-(cyclohexanecarbonylamino)-N-[2-[[1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]ethyl]piperidine-1-carboxamide (PubChem CID 66694052) has the molecular formula C26H33F3N6O3 and a molecular weight of 534.58 g/mol. Its IUPAC name is 4-(cyclohexanecarbonylamino)-N-[2-[[1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]ethyl]piperidine-1-carboxamide.
| Compound Name | 4-(cyclohexanecarbonylamino)-N-[2-[[1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]ethyl]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 66694052 |
| Molecular Formula | C26H33F3N6O3 |
| Molecular Weight | 534.58 g/mol |
| Exact Mass | 534.26 |
| IUPAC Name | 4-(cyclohexanecarbonylamino)-N-[2-[[1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]ethyl]piperidine-1-carboxamide |
| SMILES | O=C(NCCNC(=O)N1CCC(NC(=O)C2CCCCC2)CC1)c1cn(-c2ccccc2)nc1C(F)(F)F |
| InChI | InChI=1S/C26H33F3N6O3/c27-26(28,29)22-21(17-35(33-22)20-9-5-2-6-10-20)24(37)30-13-14-31-25(38)34-15-11-19(12-16-34)32-23(36)18-7-3-1-4-8-18/h2,5-6,9-10,17-19H,1,3-4,7-8,11-16H2,(H,30,37)(H,31,38)(H,32,36) |
| InChIKey | LGOGKROXJQTKCO-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 108.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.58 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|