C24H31F3N6O4 — CID 66687135
tert-butyl N-[1-[2-[[1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]ethylcarbamoyl]piperidin-4-yl]carbamate (PubChem CID 66687135) has the molecular formula C24H31F3N6O4 and a molecular weight of 524.54 g/mol. Its IUPAC name is tert-butyl N-[1-[2-[[1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]ethylcarbamoyl]piperidin-4-yl]carbamate.
| Compound Name | tert-butyl N-[1-[2-[[1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]ethylcarbamoyl]piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 66687135 |
| Molecular Formula | C24H31F3N6O4 |
| Molecular Weight | 524.54 g/mol |
| Exact Mass | 524.24 |
| IUPAC Name | tert-butyl N-[1-[2-[[1-phenyl-3-(trifluoromethyl)pyrazole-4-carbonyl]amino]ethylcarbamoyl]piperidin-4-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CCN(C(=O)NCCNC(=O)c2cn(-c3ccccc3)nc2C(F)(F)F)CC1 |
| InChI | InChI=1S/C24H31F3N6O4/c1-23(2,3)37-22(36)30-16-9-13-32(14-10-16)21(35)29-12-11-28-20(34)18-15-33(17-7-5-4-6-8-17)31-19(18)24(25,26)27/h4-8,15-16H,9-14H2,1-3H3,(H,28,34)(H,29,35)(H,30,36) |
| InChIKey | QIQUSWWXRUTNKF-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 117.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.54 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|