C5H3BrIN3S — CID 66690731
2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 66690731) has the molecular formula C5H3BrIN3S and a molecular weight of 343.98 g/mol. Its IUPAC name is 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 66690731 |
| Molecular Formula | C5H3BrIN3S |
| Molecular Weight | 343.98 g/mol |
| Exact Mass | 342.83 |
| IUPAC Name | 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | Cc1c(I)nc2sc(Br)nn12 |
| InChI | InChI=1S/C5H3BrIN3S/c1-2-3(7)8-5-10(2)9-4(6)11-5/h1H3 |
| InChIKey | WNNLYVWTFFRXLF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.98 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|