About 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole
2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 66690731) has the molecular formula C5H3BrIN3S
and a molecular weight of 343.98 g/mol. Its IUPAC name is 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole.
Molecular Properties
| Compound Name | 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole |
| PubChem CID | 66690731 |
| Molecular Formula | C5H3BrIN3S |
| Molecular Weight | 343.98 g/mol |
| Exact Mass | 342.83 |
| IUPAC Name | 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | Cc1c(I)nc2sc(Br)nn12 |
| InChI | InChI=1S/C5H3BrIN3S/c1-2-3(7)8-5-10(2)9-4(6)11-5/h1H3 |
| InChIKey | WNNLYVWTFFRXLF-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.98 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole?
The IUPAC name of 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole (CID 66690731) is 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole.
What is the SMILES notation for 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole?
The canonical SMILES for 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole is Cc1c(I)nc2sc(Br)nn12.
What is the InChIKey of 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole?
The InChIKey is WNNLYVWTFFRXLF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H3BrIN3S/c1-2-3(7)8-5-10(2)9-4(6)11-5/h1H3.
What are the key properties of 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole?
2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole has a molecular weight of 343.98 g/mol, XLogP of 2.47, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-6-iodo-5-methylimidazo[2,1-b][1,3,4]thiadiazole is sourced from PubChem (CID 66690731), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).