C8H7N3S — CID 107646710
6-ethynyl-2,5-dimethylimidazo[2,1-b][1,3,4]thiadiazole (PubChem CID 107646710) has the molecular formula C8H7N3S and a molecular weight of 177.23 g/mol. Its IUPAC name is 6-ethynyl-2,5-dimethylimidazo[2,1-b][1,3,4]thiadiazole.
| Compound Name | 6-ethynyl-2,5-dimethylimidazo[2,1-b][1,3,4]thiadiazole |
|---|---|
| PubChem CID | 107646710 |
| Molecular Formula | C8H7N3S |
| Molecular Weight | 177.23 g/mol |
| Exact Mass | 177.04 |
| IUPAC Name | 6-ethynyl-2,5-dimethylimidazo[2,1-b][1,3,4]thiadiazole |
| SMILES | C#Cc1nc2sc(C)nn2c1C |
| InChI | InChI=1S/C8H7N3S/c1-4-7-5(2)11-8(9-7)12-6(3)10-11/h1H,2-3H3 |
| InChIKey | RRXRGQXABWKDNU-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 30.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 177.23 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|