C4H4N4S2 — CID 5374303
6-methyl-2H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-3-thione (PubChem CID 5374303) has the molecular formula C4H4N4S2 and a molecular weight of 172.24 g/mol. Its IUPAC name is 6-methyl-2H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-3-thione.
| Compound Name | 6-methyl-2H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-3-thione |
|---|---|
| PubChem CID | 5374303 |
| Molecular Formula | C4H4N4S2 |
| Molecular Weight | 172.24 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | 6-methyl-2H-[1,2,4]triazolo[3,4-b][1,3,4]thiadiazole-3-thione |
| SMILES | Cc1nn2c(=S)[nH]nc2s1 |
| InChI | InChI=1S/C4H4N4S2/c1-2-7-8-3(9)5-6-4(8)10-2/h1H3,(H,5,9) |
| InChIKey | PDASXRXJUZFOPX-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.24 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|