C13H23N3O4 — CID 66693827
ethyl 5-[(2-methylpropanoylamino)carbamoyl]piperidine-2-carboxylate (PubChem CID 66693827) has the molecular formula C13H23N3O4 and a molecular weight of 285.34 g/mol. Its IUPAC name is ethyl 5-[(2-methylpropanoylamino)carbamoyl]piperidine-2-carboxylate.
| Compound Name | ethyl 5-[(2-methylpropanoylamino)carbamoyl]piperidine-2-carboxylate |
|---|---|
| PubChem CID | 66693827 |
| Molecular Formula | C13H23N3O4 |
| Molecular Weight | 285.34 g/mol |
| Exact Mass | 285.17 |
| IUPAC Name | ethyl 5-[(2-methylpropanoylamino)carbamoyl]piperidine-2-carboxylate |
| SMILES | CCOC(=O)C1CCC(C(=O)NNC(=O)C(C)C)CN1 |
| InChI | InChI=1S/C13H23N3O4/c1-4-20-13(19)10-6-5-9(7-14-10)12(18)16-15-11(17)8(2)3/h8-10,14H,4-7H2,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | QIDLDGCRQALXTP-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.34 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|