C17H16F2N6O — CID 66695557
5-[(2R,4S)-2-(3-amino-5-fluorophenyl)-4-fluoropyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide (PubChem CID 66695557) has the molecular formula C17H16F2N6O and a molecular weight of 358.35 g/mol. Its IUPAC name is 5-[(2R,4S)-2-(3-amino-5-fluorophenyl)-4-fluoropyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide.
| Compound Name | 5-[(2R,4S)-2-(3-amino-5-fluorophenyl)-4-fluoropyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
|---|---|
| PubChem CID | 66695557 |
| Molecular Formula | C17H16F2N6O |
| Molecular Weight | 358.35 g/mol |
| Exact Mass | 358.14 |
| IUPAC Name | 5-[(2R,4S)-2-(3-amino-5-fluorophenyl)-4-fluoropyrrolidin-1-yl]pyrazolo[1,5-a]pyrimidine-3-carboxamide |
| SMILES | NC(=O)c1cnn2ccc(N3C[C@@H](F)C[C@@H]3c3cc(N)cc(F)c3)nc12 |
| InChI | InChI=1S/C17H16F2N6O/c18-10-3-9(4-12(20)5-10)14-6-11(19)8-24(14)15-1-2-25-17(23-15)13(7-22-25)16(21)26/h1-5,7,11,14H,6,8,20H2,(H2,21,26)/t11-,14+/m0/s1 |
| InChIKey | NCGQQIFDCXTQHF-SMDDNHRTSA-N |
| XLogP | 1.84 |
| TPSA | 102.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.35 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|