C8H8F3IN2O — CID 66697558
3-(1-aminoethyl)-4-iodo-6-(trifluoromethyl)-1H-pyridin-2-one (PubChem CID 66697558) has the molecular formula C8H8F3IN2O and a molecular weight of 332.06 g/mol. Its IUPAC name is 3-(1-aminoethyl)-4-iodo-6-(trifluoromethyl)-1H-pyridin-2-one.
| Compound Name | 3-(1-aminoethyl)-4-iodo-6-(trifluoromethyl)-1H-pyridin-2-one |
|---|---|
| PubChem CID | 66697558 |
| Molecular Formula | C8H8F3IN2O |
| Molecular Weight | 332.06 g/mol |
| Exact Mass | 331.96 |
| IUPAC Name | 3-(1-aminoethyl)-4-iodo-6-(trifluoromethyl)-1H-pyridin-2-one |
| SMILES | CC(N)c1c(I)cc(C(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C8H8F3IN2O/c1-3(13)6-4(12)2-5(8(9,10)11)14-7(6)15/h2-3H,13H2,1H3,(H,14,15) |
| InChIKey | YQTFGOOSBFNRKQ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.06 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|