C30H25Cl3N2O3S — CID 66697779
N-[4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methoxythiophene-2-carbonyl]-4-phenylpiperidine-4-carboxamide (PubChem CID 66697779) has the molecular formula C30H25Cl3N2O3S and a molecular weight of 599.97 g/mol. Its IUPAC name is N-[4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methoxythiophene-2-carbonyl]-4-phenylpiperidine-4-carboxamide.
| Compound Name | N-[4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methoxythiophene-2-carbonyl]-4-phenylpiperidine-4-carboxamide |
|---|---|
| PubChem CID | 66697779 |
| Molecular Formula | C30H25Cl3N2O3S |
| Molecular Weight | 599.97 g/mol |
| Exact Mass | 598.07 |
| IUPAC Name | N-[4-(4-chlorophenyl)-5-(2,4-dichlorophenyl)-3-methoxythiophene-2-carbonyl]-4-phenylpiperidine-4-carboxamide |
| SMILES | COc1c(C(=O)NC(=O)C2(c3ccccc3)CCNCC2)sc(-c2ccc(Cl)cc2Cl)c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C30H25Cl3N2O3S/c1-38-25-24(18-7-9-20(31)10-8-18)26(22-12-11-21(32)17-23(22)33)39-27(25)28(36)35-29(37)30(13-15-34-16-14-30)19-5-3-2-4-6-19/h2-12,17,34H,13-16H2,1H3,(H,35,36,37) |
| InChIKey | LZGHUWJGVYLUAF-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.97 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|