C15H16N2S2 — CID 66704196
4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazole (PubChem CID 66704196) has the molecular formula C15H16N2S2 and a molecular weight of 288.44 g/mol. Its IUPAC name is 4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazole.
| Compound Name | 4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazole |
|---|---|
| PubChem CID | 66704196 |
| Molecular Formula | C15H16N2S2 |
| Molecular Weight | 288.44 g/mol |
| Exact Mass | 288.08 |
| IUPAC Name | 4,5-bis(2,5-dimethylthiophen-3-yl)-1H-imidazole |
| SMILES | Cc1cc(-c2nc[nH]c2-c2cc(C)sc2C)c(C)s1 |
| InChI | InChI=1S/C15H16N2S2/c1-8-5-12(10(3)18-8)14-15(17-7-16-14)13-6-9(2)19-11(13)4/h5-7H,1-4H3,(H,16,17) |
| InChIKey | CUUOZGCAYQLEJS-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 28.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.44 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |