C18H35N3O2 — CID 66704392
pentyl N-cyclohexyl-N'-(2-morpholin-4-ylethyl)carbamimidate (PubChem CID 66704392) has the molecular formula C18H35N3O2 and a molecular weight of 325.50 g/mol. Its IUPAC name is pentyl N-cyclohexyl-N'-(2-morpholin-4-ylethyl)carbamimidate.
| Compound Name | pentyl N-cyclohexyl-N'-(2-morpholin-4-ylethyl)carbamimidate |
|---|---|
| PubChem CID | 66704392 |
| Molecular Formula | C18H35N3O2 |
| Molecular Weight | 325.50 g/mol |
| Exact Mass | 325.27 |
| IUPAC Name | pentyl N-cyclohexyl-N'-(2-morpholin-4-ylethyl)carbamimidate |
| SMILES | CCCCCO/C(=N\CCN1CCOCC1)NC1CCCCC1 |
| InChI | InChI=1S/C18H35N3O2/c1-2-3-7-14-23-18(20-17-8-5-4-6-9-17)19-10-11-21-12-15-22-16-13-21/h17H,2-16H2,1H3,(H,19,20) |
| InChIKey | BXGPQNFTKFVSMP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 46.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.50 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|