C20H20ClN3O4S — CID 66707413
N-(1,3-benzothiazol-6-ylmethyl)-7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;oxalic acid (PubChem CID 66707413) has the molecular formula C20H20ClN3O4S and a molecular weight of 433.92 g/mol. Its IUPAC name is N-(1,3-benzothiazol-6-ylmethyl)-7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;oxalic acid.
| Compound Name | N-(1,3-benzothiazol-6-ylmethyl)-7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;oxalic acid |
|---|---|
| PubChem CID | 66707413 |
| Molecular Formula | C20H20ClN3O4S |
| Molecular Weight | 433.92 g/mol |
| Exact Mass | 433.09 |
| IUPAC Name | N-(1,3-benzothiazol-6-ylmethyl)-7-chloro-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine;oxalic acid |
| SMILES | Clc1ccc2c(c1NCc1ccc3ncsc3c1)CCNCC2.O=C(O)C(=O)O |
| InChI | InChI=1S/C18H18ClN3S.C2H2O4/c19-15-3-2-13-5-7-20-8-6-14(13)18(15)21-10-12-1-4-16-17(9-12)23-11-22-16;3-1(4)2(5)6/h1-4,9,11,20-21H,5-8,10H2;(H,3,4)(H,5,6) |
| InChIKey | DYZBIQXZPRUBNH-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 111.55 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.92 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|