C22H27ClN2O2S — CID 87379202
7-chloro-N-[[4-(2,2-dimethyl-1-sulfonylpropyl)phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine (PubChem CID 87379202) has the molecular formula C22H27ClN2O2S and a molecular weight of 418.99 g/mol. Its IUPAC name is 7-chloro-N-[[4-(2,2-dimethyl-1-sulfonylpropyl)phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine.
| Compound Name | 7-chloro-N-[[4-(2,2-dimethyl-1-sulfonylpropyl)phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine |
|---|---|
| PubChem CID | 87379202 |
| Molecular Formula | C22H27ClN2O2S |
| Molecular Weight | 418.99 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | 7-chloro-N-[[4-(2,2-dimethyl-1-sulfonylpropyl)phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine |
| SMILES | CC(C)(C)C(c1ccc(CNc2c(Cl)ccc3c2CCNCC3)cc1)=S(=O)=O |
| InChI | InChI=1S/C22H27ClN2O2S/c1-22(2,3)21(28(26)27)17-6-4-15(5-7-17)14-25-20-18-11-13-24-12-10-16(18)8-9-19(20)23/h4-9,24-25H,10-14H2,1-3H3 |
| InChIKey | ZBVCQWKYLHRVBI-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.99 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|