C25H32ClN3O5 — CID 89147580
butanedioic acid;7-chloro-N-[[4-[(Z)-N-ethoxy-C-methylcarbonimidoyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine (PubChem CID 89147580) has the molecular formula C25H32ClN3O5 and a molecular weight of 490.00 g/mol. Its IUPAC name is butanedioic acid;7-chloro-N-[[4-[(Z)-N-ethoxy-C-methylcarbonimidoyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine.
| Compound Name | butanedioic acid;7-chloro-N-[[4-[(Z)-N-ethoxy-C-methylcarbonimidoyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine |
|---|---|
| PubChem CID | 89147580 |
| Molecular Formula | C25H32ClN3O5 |
| Molecular Weight | 490.00 g/mol |
| Exact Mass | 489.20 |
| IUPAC Name | butanedioic acid;7-chloro-N-[[4-[(Z)-N-ethoxy-C-methylcarbonimidoyl]phenyl]methyl]-2,3,4,5-tetrahydro-1H-3-benzazepin-6-amine |
| SMILES | CCO/N=C(/C)c1ccc(CNc2c(Cl)ccc3c2CCNCC3)cc1.O=C(O)CCC(=O)O |
| InChI | InChI=1S/C21H26ClN3O.C4H6O4/c1-3-26-25-15(2)17-6-4-16(5-7-17)14-24-21-19-11-13-23-12-10-18(19)8-9-20(21)22;5-3(6)1-2-4(7)8/h4-9,23-24H,3,10-14H2,1-2H3;1-2H2,(H,5,6)(H,7,8)/b25-15-; |
| InChIKey | PKCTWOMMLXANLC-WMJMVBMNSA-N |
| XLogP | 4.34 |
| TPSA | 120.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.00 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|