C19H27NO2 — CID 66708195
(9S,10R,13S)-3-amino-10,13-dimethyl-4,5,6,7,9,11,12,17-octahydro-3H-cyclopenta[a]phenanthrene-7,17-diol (PubChem CID 66708195) has the molecular formula C19H27NO2 and a molecular weight of 301.43 g/mol. Its IUPAC name is (9S,10R,13S)-3-amino-10,13-dimethyl-4,5,6,7,9,11,12,17-octahydro-3H-cyclopenta[a]phenanthrene-7,17-diol.
| Compound Name | (9S,10R,13S)-3-amino-10,13-dimethyl-4,5,6,7,9,11,12,17-octahydro-3H-cyclopenta[a]phenanthrene-7,17-diol |
|---|---|
| PubChem CID | 66708195 |
| Molecular Formula | C19H27NO2 |
| Molecular Weight | 301.43 g/mol |
| Exact Mass | 301.20 |
| IUPAC Name | (9S,10R,13S)-3-amino-10,13-dimethyl-4,5,6,7,9,11,12,17-octahydro-3H-cyclopenta[a]phenanthrene-7,17-diol |
| SMILES | C[C@]12CC[C@@H]3C(=C1C=CC2O)C(O)CC1CC(N)C=C[C@@]13C |
| InChI | InChI=1S/C19H27NO2/c1-18-7-5-12(20)9-11(18)10-15(21)17-13-3-4-16(22)19(13,2)8-6-14(17)18/h3-5,7,11-12,14-16,21-22H,6,8-10,20H2,1-2H3/t11?,12?,14-,15?,16?,18+,19+/m1/s1 |
| InChIKey | BVKZVWDEKWEMNE-QQVDZGHYSA-N |
| XLogP | 2.30 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.43 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|